C21H36O5 — CID 57241049
3-(7-methylnonan-4-yl)-6-(oxan-2-yloxymethyl)oxane-2,4-dione (PubChem CID 57241049) has the molecular formula C21H36O5 and a molecular weight of 368.51 g/mol. Its IUPAC name is 3-(7-methylnonan-4-yl)-6-(oxan-2-yloxymethyl)oxane-2,4-dione.
| Compound Name | 3-(7-methylnonan-4-yl)-6-(oxan-2-yloxymethyl)oxane-2,4-dione |
|---|---|
| PubChem CID | 57241049 |
| Molecular Formula | C21H36O5 |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | 3-(7-methylnonan-4-yl)-6-(oxan-2-yloxymethyl)oxane-2,4-dione |
| SMILES | CCCC(CCC(C)CC)C1C(=O)CC(COC2CCCCO2)OC1=O |
| InChI | InChI=1S/C21H36O5/c1-4-8-16(11-10-15(3)5-2)20-18(22)13-17(26-21(20)23)14-25-19-9-6-7-12-24-19/h15-17,19-20H,4-14H2,1-3H3 |
| InChIKey | ZVNWVHHERJLZFF-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|