C15H26N2O3 — CID 57245530
tert-butyl 2,2-dimethyl-3a,4,5,6,9,9a-hexahydro-[1,3]oxazolo[5,4-c]azocine-1-carboxylate (PubChem CID 57245530) has the molecular formula C15H26N2O3 and a molecular weight of 282.38 g/mol. Its IUPAC name is tert-butyl 2,2-dimethyl-3a,4,5,6,9,9a-hexahydro-[1,3]oxazolo[5,4-c]azocine-1-carboxylate.
| Compound Name | tert-butyl 2,2-dimethyl-3a,4,5,6,9,9a-hexahydro-[1,3]oxazolo[5,4-c]azocine-1-carboxylate |
|---|---|
| PubChem CID | 57245530 |
| Molecular Formula | C15H26N2O3 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | tert-butyl 2,2-dimethyl-3a,4,5,6,9,9a-hexahydro-[1,3]oxazolo[5,4-c]azocine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CC=CCNCC2OC1(C)C |
| InChI | InChI=1S/C15H26N2O3/c1-14(2,3)20-13(18)17-11-8-6-7-9-16-10-12(11)19-15(17,4)5/h6-7,11-12,16H,8-10H2,1-5H3 |
| InChIKey | YXNFRJMAZFPAQW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|