C20H23Cl2NO — CID 57247335
4-[1-(2,5-dichlorophenyl)ethoxymethyl]-4-phenylpiperidine (PubChem CID 57247335) has the molecular formula C20H23Cl2NO and a molecular weight of 364.32 g/mol. Its IUPAC name is 4-[1-(2,5-dichlorophenyl)ethoxymethyl]-4-phenylpiperidine.
| Compound Name | 4-[1-(2,5-dichlorophenyl)ethoxymethyl]-4-phenylpiperidine |
|---|---|
| PubChem CID | 57247335 |
| Molecular Formula | C20H23Cl2NO |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 4-[1-(2,5-dichlorophenyl)ethoxymethyl]-4-phenylpiperidine |
| SMILES | CC(OCC1(c2ccccc2)CCNCC1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C20H23Cl2NO/c1-15(18-13-17(21)7-8-19(18)22)24-14-20(9-11-23-12-10-20)16-5-3-2-4-6-16/h2-8,13,15,23H,9-12,14H2,1H3 |
| InChIKey | DCBZWIIFVLQTJH-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |