C19H22ClNO — CID 19960203
4-[(3-chlorophenyl)methoxymethyl]-4-phenylpiperidine (PubChem CID 19960203) has the molecular formula C19H22ClNO and a molecular weight of 315.84 g/mol. Its IUPAC name is 4-[(3-chlorophenyl)methoxymethyl]-4-phenylpiperidine.
| Compound Name | 4-[(3-chlorophenyl)methoxymethyl]-4-phenylpiperidine |
|---|---|
| PubChem CID | 19960203 |
| Molecular Formula | C19H22ClNO |
| Molecular Weight | 315.84 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 4-[(3-chlorophenyl)methoxymethyl]-4-phenylpiperidine |
| SMILES | Clc1cccc(COCC2(c3ccccc3)CCNCC2)c1 |
| InChI | InChI=1S/C19H22ClNO/c20-18-8-4-5-16(13-18)14-22-15-19(9-11-21-12-10-19)17-6-2-1-3-7-17/h1-8,13,21H,9-12,14-15H2 |
| InChIKey | JMHFEACLGLIGNT-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.84 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |