C14H22O9 — CID 57249188
1-O,2-O-diethyl 3-O-(2-oxoethyl) 2-ethylperoxypropane-1,2,3-tricarboxylate (PubChem CID 57249188) has the molecular formula C14H22O9 and a molecular weight of 334.32 g/mol. Its IUPAC name is 1-O,2-O-diethyl 3-O-(2-oxoethyl) 2-ethylperoxypropane-1,2,3-tricarboxylate.
| Compound Name | 1-O,2-O-diethyl 3-O-(2-oxoethyl) 2-ethylperoxypropane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 57249188 |
| Molecular Formula | C14H22O9 |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 1-O,2-O-diethyl 3-O-(2-oxoethyl) 2-ethylperoxypropane-1,2,3-tricarboxylate |
| SMILES | CCOOC(CC(=O)OCC)(CC(=O)OCC=O)C(=O)OCC |
| InChI | InChI=1S/C14H22O9/c1-4-19-11(16)9-14(23-22-6-3,13(18)20-5-2)10-12(17)21-8-7-15/h7H,4-6,8-10H2,1-3H3 |
| InChIKey | UHRMDSMIKWRLDM-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|