C9H16O — CID 57249415
2,3-diethyl-3,4-dihydro-2H-pyran (PubChem CID 57249415) has the molecular formula C9H16O and a molecular weight of 140.23 g/mol. Its IUPAC name is 2,3-diethyl-3,4-dihydro-2H-pyran.
| Compound Name | 2,3-diethyl-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 57249415 |
| Molecular Formula | C9H16O |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.12 |
| IUPAC Name | 2,3-diethyl-3,4-dihydro-2H-pyran |
| SMILES | CCC1CC=COC1CC |
| InChI | InChI=1S/C9H16O/c1-3-8-6-5-7-10-9(8)4-2/h5,7-9H,3-4,6H2,1-2H3 |
| InChIKey | KRWCPZUUPYQOQF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |