C39H49N3O9Si — CID 57249527
1-[(2R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-nitroethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 57249527) has the molecular formula C39H49N3O9Si and a molecular weight of 731.92 g/mol. Its IUPAC name is 1-[(2R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-nitroethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-nitroethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 57249527 |
| Molecular Formula | C39H49N3O9Si |
| Molecular Weight | 731.92 g/mol |
| Exact Mass | 731.32 |
| IUPAC Name | 1-[(2R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-nitroethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@](CC[N+](=O)[O-])(n3cc(C)c(=O)[nH]c3=O)CC2O[Si](C)(C)C(C)(C)C)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C39H49N3O9Si/c1-27-25-41(36(44)40-35(27)43)38(22-23-42(45)46)24-33(51-52(7,8)37(2,3)4)34(50-38)26-49-39(28-12-10-9-11-13-28,29-14-18-31(47-5)19-15-29)30-16-20-32(48-6)21-17-30/h9-21,25,33-34H,22-24,26H2,1-8H3,(H,40,43,44)/t33?,34-,38-/m1/s1 |
| InChIKey | MGXJRWJXERRBPP-MHRCNDRKSA-N |
| XLogP | 6.37 |
| TPSA | 144.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.92 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|