C23H26F3N3O4 — CID 57250252
N-(3,3-dimethyl-1-oxobutan-2-yl)-2-[(3-methylphenyl)carbamoylamino]-N-[3-(trifluoromethoxy)phenyl]acetamide (PubChem CID 57250252) has the molecular formula C23H26F3N3O4 and a molecular weight of 465.47 g/mol. Its IUPAC name is N-(3,3-dimethyl-1-oxobutan-2-yl)-2-[(3-methylphenyl)carbamoylamino]-N-[3-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | N-(3,3-dimethyl-1-oxobutan-2-yl)-2-[(3-methylphenyl)carbamoylamino]-N-[3-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 57250252 |
| Molecular Formula | C23H26F3N3O4 |
| Molecular Weight | 465.47 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | N-(3,3-dimethyl-1-oxobutan-2-yl)-2-[(3-methylphenyl)carbamoylamino]-N-[3-(trifluoromethoxy)phenyl]acetamide |
| SMILES | Cc1cccc(NC(=O)NCC(=O)N(c2cccc(OC(F)(F)F)c2)C(C=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C23H26F3N3O4/c1-15-7-5-8-16(11-15)28-21(32)27-13-20(31)29(19(14-30)22(2,3)4)17-9-6-10-18(12-17)33-23(24,25)26/h5-12,14,19H,13H2,1-4H3,(H2,27,28,32) |
| InChIKey | KPZPCWTZJJQQBT-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.47 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|