C8H13ClO3 — CID 57250732
3-(2-chloroethoxy)-2,2-dimethylcyclopropane-1-carboxylic acid (PubChem CID 57250732) has the molecular formula C8H13ClO3 and a molecular weight of 192.64 g/mol. Its IUPAC name is 3-(2-chloroethoxy)-2,2-dimethylcyclopropane-1-carboxylic acid.
| Compound Name | 3-(2-chloroethoxy)-2,2-dimethylcyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 57250732 |
| Molecular Formula | C8H13ClO3 |
| Molecular Weight | 192.64 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | 3-(2-chloroethoxy)-2,2-dimethylcyclopropane-1-carboxylic acid |
| SMILES | CC1(C)C(OCCCl)C1C(=O)O |
| InChI | InChI=1S/C8H13ClO3/c1-8(2)5(7(10)11)6(8)12-4-3-9/h5-6H,3-4H2,1-2H3,(H,10,11) |
| InChIKey | DLKDQVFWKQWAFF-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.64 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|