C11H19IO3 — CID 23338847
3-(1-iodopentoxy)-2,2-dimethylcyclopropane-1-carboxylic acid (PubChem CID 23338847) has the molecular formula C11H19IO3 and a molecular weight of 326.17 g/mol. Its IUPAC name is 3-(1-iodopentoxy)-2,2-dimethylcyclopropane-1-carboxylic acid.
| Compound Name | 3-(1-iodopentoxy)-2,2-dimethylcyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 23338847 |
| Molecular Formula | C11H19IO3 |
| Molecular Weight | 326.17 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 3-(1-iodopentoxy)-2,2-dimethylcyclopropane-1-carboxylic acid |
| SMILES | CCCCC(I)OC1C(C(=O)O)C1(C)C |
| InChI | InChI=1S/C11H19IO3/c1-4-5-6-7(12)15-9-8(10(13)14)11(9,2)3/h7-9H,4-6H2,1-3H3,(H,13,14) |
| InChIKey | CZHDTLFVNNGWHB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.17 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|