About 1-iodopentoxysilane
1-iodopentoxysilane (PubChem CID 173081223) has the molecular formula C5H13IOSi
and a molecular weight of 244.15 g/mol. Its IUPAC name is 1-iodopentoxysilane.
Molecular Properties
| Compound Name | 1-iodopentoxysilane |
| PubChem CID | 173081223 |
| Molecular Formula | C5H13IOSi |
| Molecular Weight | 244.15 g/mol |
| Exact Mass | 243.98 |
| IUPAC Name | 1-iodopentoxysilane |
| SMILES | CCCCC(I)O[SiH3] |
| InChI | InChI=1S/C5H13IOSi/c1-2-3-4-5(6)7-8/h5H,2-4H2,1,8H3 |
| InChIKey | FBLVKMMAUMYPPA-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.15 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-iodopentoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodopentoxysilane?
The IUPAC name of 1-iodopentoxysilane (CID 173081223) is 1-iodopentoxysilane.
What is the SMILES notation for 1-iodopentoxysilane?
The canonical SMILES for 1-iodopentoxysilane is CCCCC(I)O[SiH3].
What is the InChIKey of 1-iodopentoxysilane?
The InChIKey is FBLVKMMAUMYPPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13IOSi/c1-2-3-4-5(6)7-8/h5H,2-4H2,1,8H3.
What are the key properties of 1-iodopentoxysilane?
1-iodopentoxysilane has a molecular weight of 244.15 g/mol, XLogP of 1.23, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodopentoxysilane is sourced from PubChem (CID 173081223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).