C15H20N4OS — CID 57250739
2-[4-(dimethylamino)phenyl]-N-[5-(ethylamino)-1,3-thiazol-2-yl]acetamide (PubChem CID 57250739) has the molecular formula C15H20N4OS and a molecular weight of 304.42 g/mol. Its IUPAC name is 2-[4-(dimethylamino)phenyl]-N-[5-(ethylamino)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-[4-(dimethylamino)phenyl]-N-[5-(ethylamino)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 57250739 |
| Molecular Formula | C15H20N4OS |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 2-[4-(dimethylamino)phenyl]-N-[5-(ethylamino)-1,3-thiazol-2-yl]acetamide |
| SMILES | CCNc1cnc(NC(=O)Cc2ccc(N(C)C)cc2)s1 |
| InChI | InChI=1S/C15H20N4OS/c1-4-16-14-10-17-15(21-14)18-13(20)9-11-5-7-12(8-6-11)19(2)3/h5-8,10,16H,4,9H2,1-3H3,(H,17,18,20) |
| InChIKey | MRUQHSZNBQMHDE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|