C9H16N2S — CID 57253267
1-(2-methyl-2,3-dihydrothiophen-4-yl)piperazine (PubChem CID 57253267) has the molecular formula C9H16N2S and a molecular weight of 184.31 g/mol. Its IUPAC name is 1-(2-methyl-2,3-dihydrothiophen-4-yl)piperazine.
| Compound Name | 1-(2-methyl-2,3-dihydrothiophen-4-yl)piperazine |
|---|---|
| PubChem CID | 57253267 |
| Molecular Formula | C9H16N2S |
| Molecular Weight | 184.31 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 1-(2-methyl-2,3-dihydrothiophen-4-yl)piperazine |
| SMILES | CC1CC(N2CCNCC2)=CS1 |
| InChI | InChI=1S/C9H16N2S/c1-8-6-9(7-12-8)11-4-2-10-3-5-11/h7-8,10H,2-6H2,1H3 |
| InChIKey | WPDAZUOFUVKOEK-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.31 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |