C21H15N3O3S2 — CID 57254084
5-(4-aminophenyl)-3-(2,1,3-benzothiadiazol-5-yl)-5-hydroxy-4-(thiophen-2-ylmethyl)furan-2-one (PubChem CID 57254084) has the molecular formula C21H15N3O3S2 and a molecular weight of 421.50 g/mol. Its IUPAC name is 5-(4-aminophenyl)-3-(2,1,3-benzothiadiazol-5-yl)-5-hydroxy-4-(thiophen-2-ylmethyl)furan-2-one.
| Compound Name | 5-(4-aminophenyl)-3-(2,1,3-benzothiadiazol-5-yl)-5-hydroxy-4-(thiophen-2-ylmethyl)furan-2-one |
|---|---|
| PubChem CID | 57254084 |
| Molecular Formula | C21H15N3O3S2 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.06 |
| IUPAC Name | 5-(4-aminophenyl)-3-(2,1,3-benzothiadiazol-5-yl)-5-hydroxy-4-(thiophen-2-ylmethyl)furan-2-one |
| SMILES | Nc1ccc(C2(O)OC(=O)C(c3ccc4nsnc4c3)=C2Cc2cccs2)cc1 |
| InChI | InChI=1S/C21H15N3O3S2/c22-14-6-4-13(5-7-14)21(26)16(11-15-2-1-9-28-15)19(20(25)27-21)12-3-8-17-18(10-12)24-29-23-17/h1-10,26H,11,22H2 |
| InChIKey | ZLBZAKDTWARVMP-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|