About (6-acetyloxy-5-methylcyclohexa-2,4-dien-1-yl) acetate
(6-acetyloxy-5-methylcyclohexa-2,4-dien-1-yl) acetate (PubChem CID 572544) has the molecular formula C11H14O4
and a molecular weight of 210.23 g/mol. Its IUPAC name is (6-acetyloxy-5-methylcyclohexa-2,4-dien-1-yl) acetate.
Analyze (6-acetyloxy-5-methylcyclohexa-2,4-dien-1-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-acetyloxy-5-methylcyclohexa-2,4-dien-1-yl) acetate?
The IUPAC name of (6-acetyloxy-5-methylcyclohexa-2,4-dien-1-yl) acetate (CID 572544) is (6-acetyloxy-5-methylcyclohexa-2,4-dien-1-yl) acetate.
What is the SMILES notation for (6-acetyloxy-5-methylcyclohexa-2,4-dien-1-yl) acetate?
The canonical SMILES for (6-acetyloxy-5-methylcyclohexa-2,4-dien-1-yl) acetate is CC(=O)OC1C=CC=C(C)C1OC(C)=O.
What is the InChIKey of (6-acetyloxy-5-methylcyclohexa-2,4-dien-1-yl) acetate?
The InChIKey is WVPQAFJZEOIEIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O4/c1-7-5-4-6-10(14-8(2)12)11(7)15-9(3)13/h4-6,10-11H,1-3H3.
What are the key properties of (6-acetyloxy-5-methylcyclohexa-2,4-dien-1-yl) acetate?
(6-acetyloxy-5-methylcyclohexa-2,4-dien-1-yl) acetate has a molecular weight of 210.23 g/mol, XLogP of 1.37, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-acetyloxy-5-methylcyclohexa-2,4-dien-1-yl) acetate is sourced from PubChem (CID 572544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).