C12H16O3S — CID 57254586
4-(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)butan-1-ol (PubChem CID 57254586) has the molecular formula C12H16O3S and a molecular weight of 240.32 g/mol. Its IUPAC name is 4-(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)butan-1-ol.
| Compound Name | 4-(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)butan-1-ol |
|---|---|
| PubChem CID | 57254586 |
| Molecular Formula | C12H16O3S |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 4-(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)butan-1-ol |
| SMILES | O=S1(=O)CC(CCCCO)c2ccccc21 |
| InChI | InChI=1S/C12H16O3S/c13-8-4-3-5-10-9-16(14,15)12-7-2-1-6-11(10)12/h1-2,6-7,10,13H,3-5,8-9H2 |
| InChIKey | JQQKMRADQQVQJN-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|