C12H14Cl2O2 — CID 57255262
2-[2-(3,4-dichlorophenyl)propyl]-1,3-dioxolane (PubChem CID 57255262) has the molecular formula C12H14Cl2O2 and a molecular weight of 261.15 g/mol. Its IUPAC name is 2-[2-(3,4-dichlorophenyl)propyl]-1,3-dioxolane.
| Compound Name | 2-[2-(3,4-dichlorophenyl)propyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 57255262 |
| Molecular Formula | C12H14Cl2O2 |
| Molecular Weight | 261.15 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 2-[2-(3,4-dichlorophenyl)propyl]-1,3-dioxolane |
| SMILES | CC(CC1OCCO1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H14Cl2O2/c1-8(6-12-15-4-5-16-12)9-2-3-10(13)11(14)7-9/h2-3,7-8,12H,4-6H2,1H3 |
| InChIKey | ATCCBDRWTSHURJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.15 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |