C17H17FN2O2 — CID 57255777
N-[(3-fluorophenyl)methyl]-4-oxo-6,7,8,8a-tetrahydro-3H-quinoline-3-carboxamide (PubChem CID 57255777) has the molecular formula C17H17FN2O2 and a molecular weight of 300.33 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-4-oxo-6,7,8,8a-tetrahydro-3H-quinoline-3-carboxamide.
| Compound Name | N-[(3-fluorophenyl)methyl]-4-oxo-6,7,8,8a-tetrahydro-3H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 57255777 |
| Molecular Formula | C17H17FN2O2 |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-4-oxo-6,7,8,8a-tetrahydro-3H-quinoline-3-carboxamide |
| SMILES | O=C(NCc1cccc(F)c1)C1C=NC2CCCC=C2C1=O |
| InChI | InChI=1S/C17H17FN2O2/c18-12-5-3-4-11(8-12)9-20-17(22)14-10-19-15-7-2-1-6-13(15)16(14)21/h3-6,8,10,14-15H,1-2,7,9H2,(H,20,22) |
| InChIKey | FADVNRYPDAFCRD-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|