C21H17Cl2N3O3S — CID 57257525
3-[(3,5-dichlorophenyl)carbamoyl-sulfanylamino]-4-methoxy-N-phenylbenzamide (PubChem CID 57257525) has the molecular formula C21H17Cl2N3O3S and a molecular weight of 462.36 g/mol. Its IUPAC name is 3-[(3,5-dichlorophenyl)carbamoyl-sulfanylamino]-4-methoxy-N-phenylbenzamide.
| Compound Name | 3-[(3,5-dichlorophenyl)carbamoyl-sulfanylamino]-4-methoxy-N-phenylbenzamide |
|---|---|
| PubChem CID | 57257525 |
| Molecular Formula | C21H17Cl2N3O3S |
| Molecular Weight | 462.36 g/mol |
| Exact Mass | 461.04 |
| IUPAC Name | 3-[(3,5-dichlorophenyl)carbamoyl-sulfanylamino]-4-methoxy-N-phenylbenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccccc2)cc1N(S)C(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C21H17Cl2N3O3S/c1-29-19-8-7-13(20(27)24-16-5-3-2-4-6-16)9-18(19)26(30)21(28)25-17-11-14(22)10-15(23)12-17/h2-12,30H,1H3,(H,24,27)(H,25,28) |
| InChIKey | JKQZBFTYYDNKPS-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.36 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|