C22H24N3O6S- — CID 57258625
1-[N-[(4-cyano-2-methylphenyl)carbamoyl]-4-(3-methoxy-3-oxopropyl)anilino]propan-2-yl sulfite (PubChem CID 57258625) has the molecular formula C22H24N3O6S- and a molecular weight of 458.52 g/mol. Its IUPAC name is 1-[N-[(4-cyano-2-methylphenyl)carbamoyl]-4-(3-methoxy-3-oxopropyl)anilino]propan-2-yl sulfite.
| Compound Name | 1-[N-[(4-cyano-2-methylphenyl)carbamoyl]-4-(3-methoxy-3-oxopropyl)anilino]propan-2-yl sulfite |
|---|---|
| PubChem CID | 57258625 |
| Molecular Formula | C22H24N3O6S- |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | 1-[N-[(4-cyano-2-methylphenyl)carbamoyl]-4-(3-methoxy-3-oxopropyl)anilino]propan-2-yl sulfite |
| SMILES | COC(=O)CCc1ccc(N(CC(C)OS(=O)[O-])C(=O)Nc2ccc(C#N)cc2C)cc1 |
| InChI | InChI=1S/C22H25N3O6S/c1-15-12-18(13-23)6-10-20(15)24-22(27)25(14-16(2)31-32(28)29)19-8-4-17(5-9-19)7-11-21(26)30-3/h4-6,8-10,12,16H,7,11,14H2,1-3H3,(H,24,27)(H,28,29)/p-1 |
| InChIKey | SXVOQGARROZODT-UHFFFAOYSA-M |
| XLogP | 3.21 |
| TPSA | 131.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|