C21H21N3O3 — CID 22098569
methyl 3-[4-[3-(4-cyano-2-methylphenyl)-2-oxoimidazolidin-1-yl]phenyl]propanoate (PubChem CID 22098569) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is methyl 3-[4-[3-(4-cyano-2-methylphenyl)-2-oxoimidazolidin-1-yl]phenyl]propanoate.
| Compound Name | methyl 3-[4-[3-(4-cyano-2-methylphenyl)-2-oxoimidazolidin-1-yl]phenyl]propanoate |
|---|---|
| PubChem CID | 22098569 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | methyl 3-[4-[3-(4-cyano-2-methylphenyl)-2-oxoimidazolidin-1-yl]phenyl]propanoate |
| SMILES | COC(=O)CCc1ccc(N2CCN(c3ccc(C#N)cc3C)C2=O)cc1 |
| InChI | InChI=1S/C21H21N3O3/c1-15-13-17(14-22)5-9-19(15)24-12-11-23(21(24)26)18-7-3-16(4-8-18)6-10-20(25)27-2/h3-5,7-9,13H,6,10-12H2,1-2H3 |
| InChIKey | IJGLXHXHOULJBJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 73.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |