About 2-hydroxy-2-nitroacetic acid
2-hydroxy-2-nitroacetic acid (PubChem CID 57258933) has the molecular formula C2H3NO5
and a molecular weight of 121.05 g/mol. Its IUPAC name is 2-hydroxy-2-nitroacetic acid.
Molecular Properties
| Compound Name | 2-hydroxy-2-nitroacetic acid |
| PubChem CID | 57258933 |
| Molecular Formula | C2H3NO5 |
| Molecular Weight | 121.05 g/mol |
| Exact Mass | 121.00 |
| IUPAC Name | 2-hydroxy-2-nitroacetic acid |
| SMILES | O=C(O)C(O)[N+](=O)[O-] |
| InChI | InChI=1S/C2H3NO5/c4-1(2(5)6)3(7)8/h1,4H,(H,5,6) |
| InChIKey | JMAZSSVXKRDTBL-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.05 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-2-nitroacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-2-nitroacetic acid?
The IUPAC name of 2-hydroxy-2-nitroacetic acid (CID 57258933) is 2-hydroxy-2-nitroacetic acid.
What is the SMILES notation for 2-hydroxy-2-nitroacetic acid?
The canonical SMILES for 2-hydroxy-2-nitroacetic acid is O=C(O)C(O)[N+](=O)[O-].
What is the InChIKey of 2-hydroxy-2-nitroacetic acid?
The InChIKey is JMAZSSVXKRDTBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H3NO5/c4-1(2(5)6)3(7)8/h1,4H,(H,5,6).
What are the key properties of 2-hydroxy-2-nitroacetic acid?
2-hydroxy-2-nitroacetic acid has a molecular weight of 121.05 g/mol, XLogP of -1.33, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-2-nitroacetic acid is sourced from PubChem (CID 57258933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).