C22H33N3O5 — CID 57259596
benzyl (2S)-1-tert-butyl-2-carbamoyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidine-2-carboxylate (PubChem CID 57259596) has the molecular formula C22H33N3O5 and a molecular weight of 419.52 g/mol. Its IUPAC name is benzyl (2S)-1-tert-butyl-2-carbamoyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidine-2-carboxylate.
| Compound Name | benzyl (2S)-1-tert-butyl-2-carbamoyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 57259596 |
| Molecular Formula | C22H33N3O5 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | benzyl (2S)-1-tert-butyl-2-carbamoyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(C(C)(C)C)[C@@]1(C(N)=O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H33N3O5/c1-20(2,3)25-13-12-16(24-19(28)30-21(4,5)6)22(25,17(23)26)18(27)29-14-15-10-8-7-9-11-15/h7-11,16H,12-14H2,1-6H3,(H2,23,26)(H,24,28)/t16?,22-/m0/s1 |
| InChIKey | NLCNABKXWHIMPC-XLDIYJRPSA-N |
| XLogP | 2.35 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|