C17H26N2O4 — CID 57260308
2-(1,6-diamino-2,2,4-trimethylhexyl)terephthalic acid (PubChem CID 57260308) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is 2-(1,6-diamino-2,2,4-trimethylhexyl)terephthalic acid.
| Compound Name | 2-(1,6-diamino-2,2,4-trimethylhexyl)terephthalic acid |
|---|---|
| PubChem CID | 57260308 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 2-(1,6-diamino-2,2,4-trimethylhexyl)terephthalic acid |
| SMILES | CC(CCN)CC(C)(C)C(N)c1cc(C(=O)O)ccc1C(=O)O |
| InChI | InChI=1S/C17H26N2O4/c1-10(6-7-18)9-17(2,3)14(19)13-8-11(15(20)21)4-5-12(13)16(22)23/h4-5,8,10,14H,6-7,9,18-19H2,1-3H3,(H,20,21)(H,22,23) |
| InChIKey | QKQZWYRNKKABIF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |