C10H17N — CID 57260617
1-methyl-3,4,4a,5,6,7-hexahydro-2H-quinoline (PubChem CID 57260617) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is 1-methyl-3,4,4a,5,6,7-hexahydro-2H-quinoline.
| Compound Name | 1-methyl-3,4,4a,5,6,7-hexahydro-2H-quinoline |
|---|---|
| PubChem CID | 57260617 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 1-methyl-3,4,4a,5,6,7-hexahydro-2H-quinoline |
| SMILES | CN1CCCC2CCCC=C21 |
| InChI | InChI=1S/C10H17N/c1-11-8-4-6-9-5-2-3-7-10(9)11/h7,9H,2-6,8H2,1H3 |
| InChIKey | LUSHNIFRBZHAOW-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |