C28H29N3O8 — CID 57261007
3-O-benzyl 1-O-(4-nitrophenyl) (2R)-2-(4-aminobutyl)-2-(phenylmethoxycarbonylamino)propanedioate (PubChem CID 57261007) has the molecular formula C28H29N3O8 and a molecular weight of 535.55 g/mol. Its IUPAC name is 3-O-benzyl 1-O-(4-nitrophenyl) (2R)-2-(4-aminobutyl)-2-(phenylmethoxycarbonylamino)propanedioate.
| Compound Name | 3-O-benzyl 1-O-(4-nitrophenyl) (2R)-2-(4-aminobutyl)-2-(phenylmethoxycarbonylamino)propanedioate |
|---|---|
| PubChem CID | 57261007 |
| Molecular Formula | C28H29N3O8 |
| Molecular Weight | 535.55 g/mol |
| Exact Mass | 535.20 |
| IUPAC Name | 3-O-benzyl 1-O-(4-nitrophenyl) (2R)-2-(4-aminobutyl)-2-(phenylmethoxycarbonylamino)propanedioate |
| SMILES | NCCCC[C@@](NC(=O)OCc1ccccc1)(C(=O)OCc1ccccc1)C(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H29N3O8/c29-18-8-7-17-28(25(32)37-19-21-9-3-1-4-10-21,30-27(34)38-20-22-11-5-2-6-12-22)26(33)39-24-15-13-23(14-16-24)31(35)36/h1-6,9-16H,7-8,17-20,29H2,(H,30,34)/t28-/m1/s1 |
| InChIKey | MLFIRVJRHPMAOY-MUUNZHRXSA-N |
| XLogP | 4.04 |
| TPSA | 160.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.55 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|