C18H15Cl2N3O3 — CID 57265028
3-[2-[(3,5-dichlorophenyl)carbamoylamino]ethyl]-1H-indole-2-carboxylic acid (PubChem CID 57265028) has the molecular formula C18H15Cl2N3O3 and a molecular weight of 392.24 g/mol. Its IUPAC name is 3-[2-[(3,5-dichlorophenyl)carbamoylamino]ethyl]-1H-indole-2-carboxylic acid.
| Compound Name | 3-[2-[(3,5-dichlorophenyl)carbamoylamino]ethyl]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 57265028 |
| Molecular Formula | C18H15Cl2N3O3 |
| Molecular Weight | 392.24 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | 3-[2-[(3,5-dichlorophenyl)carbamoylamino]ethyl]-1H-indole-2-carboxylic acid |
| SMILES | O=C(NCCc1c(C(=O)O)[nH]c2ccccc12)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C18H15Cl2N3O3/c19-10-7-11(20)9-12(8-10)22-18(26)21-6-5-14-13-3-1-2-4-15(13)23-16(14)17(24)25/h1-4,7-9,23H,5-6H2,(H,24,25)(H2,21,22,26) |
| InChIKey | YVGQJCUEZRQVST-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.24 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|