C12H14F2N2S — CID 57266047
4-[(2,6-difluorophenyl)methyl]-5-methyl-1,2,5,6-tetrahydropyrimidine-2-thiol (PubChem CID 57266047) has the molecular formula C12H14F2N2S and a molecular weight of 256.32 g/mol. Its IUPAC name is 4-[(2,6-difluorophenyl)methyl]-5-methyl-1,2,5,6-tetrahydropyrimidine-2-thiol.
| Compound Name | 4-[(2,6-difluorophenyl)methyl]-5-methyl-1,2,5,6-tetrahydropyrimidine-2-thiol |
|---|---|
| PubChem CID | 57266047 |
| Molecular Formula | C12H14F2N2S |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 4-[(2,6-difluorophenyl)methyl]-5-methyl-1,2,5,6-tetrahydropyrimidine-2-thiol |
| SMILES | CC1CNC(S)N=C1Cc1c(F)cccc1F |
| InChI | InChI=1S/C12H14F2N2S/c1-7-6-15-12(17)16-11(7)5-8-9(13)3-2-4-10(8)14/h2-4,7,12,15,17H,5-6H2,1H3 |
| InChIKey | KVVBUMGWCHWAFZ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|