C24H49NO4 — CID 57267470
N-(1-decoxyundecan-3-yl)-2,3-dihydroxypropanamide (PubChem CID 57267470) has the molecular formula C24H49NO4 and a molecular weight of 415.66 g/mol. Its IUPAC name is N-(1-decoxyundecan-3-yl)-2,3-dihydroxypropanamide.
| Compound Name | N-(1-decoxyundecan-3-yl)-2,3-dihydroxypropanamide |
|---|---|
| PubChem CID | 57267470 |
| Molecular Formula | C24H49NO4 |
| Molecular Weight | 415.66 g/mol |
| Exact Mass | 415.37 |
| IUPAC Name | N-(1-decoxyundecan-3-yl)-2,3-dihydroxypropanamide |
| SMILES | CCCCCCCCCCOCCC(CCCCCCCC)NC(=O)C(O)CO |
| InChI | InChI=1S/C24H49NO4/c1-3-5-7-9-11-12-14-16-19-29-20-18-22(25-24(28)23(27)21-26)17-15-13-10-8-6-4-2/h22-23,26-27H,3-21H2,1-2H3,(H,25,28) |
| InChIKey | VQKSHFMQOPJNOM-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.66 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|