C27H57NO6 — CID 21308139
(2R,3R,4R,5S)-6-(1-decoxyundecan-3-ylamino)hexane-1,2,3,4,5-pentol (PubChem CID 21308139) has the molecular formula C27H57NO6 and a molecular weight of 491.75 g/mol. Its IUPAC name is (2R,3R,4R,5S)-6-(1-decoxyundecan-3-ylamino)hexane-1,2,3,4,5-pentol.
| Compound Name | (2R,3R,4R,5S)-6-(1-decoxyundecan-3-ylamino)hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 21308139 |
| Molecular Formula | C27H57NO6 |
| Molecular Weight | 491.75 g/mol |
| Exact Mass | 491.42 |
| IUPAC Name | (2R,3R,4R,5S)-6-(1-decoxyundecan-3-ylamino)hexane-1,2,3,4,5-pentol |
| SMILES | CCCCCCCCCCOCCC(CCCCCCCC)NC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C27H57NO6/c1-3-5-7-9-11-12-14-16-19-34-20-18-23(17-15-13-10-8-6-4-2)28-21-24(30)26(32)27(33)25(31)22-29/h23-33H,3-22H2,1-2H3/t23?,24-,25+,26+,27+/m0/s1 |
| InChIKey | PSYUFYLKVYOWCR-WRNULMNLSA-N |
| XLogP | 3.68 |
| TPSA | 122.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.75 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|