C23H47NO7 — CID 54344779
11-methylpentadecyl N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]carbamate (PubChem CID 54344779) has the molecular formula C23H47NO7 and a molecular weight of 449.63 g/mol. Its IUPAC name is 11-methylpentadecyl N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]carbamate.
| Compound Name | 11-methylpentadecyl N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]carbamate |
|---|---|
| PubChem CID | 54344779 |
| Molecular Formula | C23H47NO7 |
| Molecular Weight | 449.63 g/mol |
| Exact Mass | 449.34 |
| IUPAC Name | 11-methylpentadecyl N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]carbamate |
| SMILES | CCCCC(C)CCCCCCCCCCOC(=O)NC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C23H47NO7/c1-3-4-13-18(2)14-11-9-7-5-6-8-10-12-15-31-23(30)24-16-19(26)21(28)22(29)20(27)17-25/h18-22,25-29H,3-17H2,1-2H3,(H,24,30)/t18?,19-,20+,21+,22+/m0/s1 |
| InChIKey | UBNJSDRTNMZXHQ-XFHZOHHFSA-N |
| XLogP | 2.49 |
| TPSA | 139.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.63 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|