C14H31NO4 — CID 65314677
2-[(2-hydroxy-3-octoxypropyl)amino]propane-1,3-diol (PubChem CID 65314677) has the molecular formula C14H31NO4 and a molecular weight of 277.40 g/mol. Its IUPAC name is 2-[(2-hydroxy-3-octoxypropyl)amino]propane-1,3-diol.
| Compound Name | 2-[(2-hydroxy-3-octoxypropyl)amino]propane-1,3-diol |
|---|---|
| PubChem CID | 65314677 |
| Molecular Formula | C14H31NO4 |
| Molecular Weight | 277.40 g/mol |
| Exact Mass | 277.23 |
| IUPAC Name | 2-[(2-hydroxy-3-octoxypropyl)amino]propane-1,3-diol |
| SMILES | CCCCCCCCOCC(O)CNC(CO)CO |
| InChI | InChI=1S/C14H31NO4/c1-2-3-4-5-6-7-8-19-12-14(18)9-15-13(10-16)11-17/h13-18H,2-12H2,1H3 |
| InChIKey | YUYCNHXUQLTCSO-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.40 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|