C36H42 — CID 57268598
(5,5-dimethyl-2,3,4-triphenyl-4-propan-2-ylheptan-3-yl)benzene (PubChem CID 57268598) has the molecular formula C36H42 and a molecular weight of 474.73 g/mol. Its IUPAC name is (5,5-dimethyl-2,3,4-triphenyl-4-propan-2-ylheptan-3-yl)benzene.
| Compound Name | (5,5-dimethyl-2,3,4-triphenyl-4-propan-2-ylheptan-3-yl)benzene |
|---|---|
| PubChem CID | 57268598 |
| Molecular Formula | C36H42 |
| Molecular Weight | 474.73 g/mol |
| Exact Mass | 474.33 |
| IUPAC Name | (5,5-dimethyl-2,3,4-triphenyl-4-propan-2-ylheptan-3-yl)benzene |
| SMILES | CCC(C)(C)C(c1ccccc1)(C(C)C)C(c1ccccc1)(c1ccccc1)C(C)c1ccccc1 |
| InChI | InChI=1S/C36H42/c1-7-34(5,6)36(28(2)3,33-26-18-11-19-27-33)35(31-22-14-9-15-23-31,32-24-16-10-17-25-32)29(4)30-20-12-8-13-21-30/h8-29H,7H2,1-6H3 |
| InChIKey | QAIWYOUAHVGFJZ-UHFFFAOYSA-N |
| XLogP | 9.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.73 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |