C12H15ClN3O2+ — CID 57272668
1-chloro-6-hydroxy-4-methyl-5-(3-propyl-1H-imidazol-3-ium-2-yl)pyridin-2-one (PubChem CID 57272668) has the molecular formula C12H15ClN3O2+ and a molecular weight of 268.72 g/mol. Its IUPAC name is 1-chloro-6-hydroxy-4-methyl-5-(3-propyl-1H-imidazol-3-ium-2-yl)pyridin-2-one.
| Compound Name | 1-chloro-6-hydroxy-4-methyl-5-(3-propyl-1H-imidazol-3-ium-2-yl)pyridin-2-one |
|---|---|
| PubChem CID | 57272668 |
| Molecular Formula | C12H15ClN3O2+ |
| Molecular Weight | 268.72 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 1-chloro-6-hydroxy-4-methyl-5-(3-propyl-1H-imidazol-3-ium-2-yl)pyridin-2-one |
| SMILES | CCC[n+]1cc[nH]c1-c1c(C)cc(=O)n(Cl)c1O |
| InChI | InChI=1S/C12H14ClN3O2/c1-3-5-15-6-4-14-11(15)10-8(2)7-9(17)16(13)12(10)18/h4,6-7H,3,5H2,1-2H3,(H,14,17,18)/p+1 |
| InChIKey | AFSJPWZTNKIIHF-UHFFFAOYSA-O |
| XLogP | 1.56 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.72 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|