C9H13ClN6S — CID 57273711
1-[2-[(2-chloro-1,3-thiazol-4-yl)methylamino]ethyl]-3-cyano-2-methylguanidine (PubChem CID 57273711) has the molecular formula C9H13ClN6S and a molecular weight of 272.76 g/mol. Its IUPAC name is 1-[2-[(2-chloro-1,3-thiazol-4-yl)methylamino]ethyl]-3-cyano-2-methylguanidine.
| Compound Name | 1-[2-[(2-chloro-1,3-thiazol-4-yl)methylamino]ethyl]-3-cyano-2-methylguanidine |
|---|---|
| PubChem CID | 57273711 |
| Molecular Formula | C9H13ClN6S |
| Molecular Weight | 272.76 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 1-[2-[(2-chloro-1,3-thiazol-4-yl)methylamino]ethyl]-3-cyano-2-methylguanidine |
| SMILES | C/N=C(\NC#N)NCCNCc1csc(Cl)n1 |
| InChI | InChI=1S/C9H13ClN6S/c1-12-9(15-6-11)14-3-2-13-4-7-5-17-8(10)16-7/h5,13H,2-4H2,1H3,(H2,12,14,15) |
| InChIKey | FCWPMMKXGOBNOD-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.76 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|