C37H42N2O2 — CID 57274655
N-[(2S,5S)-5-(dibenzylamino)-4-oxo-1,6-diphenylhexan-2-yl]-2,2-dimethylpropanamide (PubChem CID 57274655) has the molecular formula C37H42N2O2 and a molecular weight of 546.76 g/mol. Its IUPAC name is N-[(2S,5S)-5-(dibenzylamino)-4-oxo-1,6-diphenylhexan-2-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[(2S,5S)-5-(dibenzylamino)-4-oxo-1,6-diphenylhexan-2-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 57274655 |
| Molecular Formula | C37H42N2O2 |
| Molecular Weight | 546.76 g/mol |
| Exact Mass | 546.32 |
| IUPAC Name | N-[(2S,5S)-5-(dibenzylamino)-4-oxo-1,6-diphenylhexan-2-yl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)N[C@H](CC(=O)[C@H](Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C37H42N2O2/c1-37(2,3)36(41)38-33(24-29-16-8-4-9-17-29)26-35(40)34(25-30-18-10-5-11-19-30)39(27-31-20-12-6-13-21-31)28-32-22-14-7-15-23-32/h4-23,33-34H,24-28H2,1-3H3,(H,38,41)/t33-,34-/m0/s1 |
| InChIKey | RLWWFCMSTKMLHL-HEVIKAOCSA-N |
| XLogP | 7.03 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.76 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |