C34H35N3O6 — CID 57275090
(3S)-4-[2-(4-methoxycarbonylphenyl)-2-(4-methylpentanoyl)hydrazinyl]-4-oxo-3-[3-(4-phenylphenyl)pyrrol-1-yl]butanoic acid (PubChem CID 57275090) has the molecular formula C34H35N3O6 and a molecular weight of 581.67 g/mol. Its IUPAC name is (3S)-4-[2-(4-methoxycarbonylphenyl)-2-(4-methylpentanoyl)hydrazinyl]-4-oxo-3-[3-(4-phenylphenyl)pyrrol-1-yl]butanoic acid.
| Compound Name | (3S)-4-[2-(4-methoxycarbonylphenyl)-2-(4-methylpentanoyl)hydrazinyl]-4-oxo-3-[3-(4-phenylphenyl)pyrrol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 57275090 |
| Molecular Formula | C34H35N3O6 |
| Molecular Weight | 581.67 g/mol |
| Exact Mass | 581.25 |
| IUPAC Name | (3S)-4-[2-(4-methoxycarbonylphenyl)-2-(4-methylpentanoyl)hydrazinyl]-4-oxo-3-[3-(4-phenylphenyl)pyrrol-1-yl]butanoic acid |
| SMILES | COC(=O)c1ccc(N(NC(=O)[C@H](CC(=O)O)n2ccc(-c3ccc(-c4ccccc4)cc3)c2)C(=O)CCC(C)C)cc1 |
| InChI | InChI=1S/C34H35N3O6/c1-23(2)9-18-31(38)37(29-16-14-27(15-17-29)34(42)43-3)35-33(41)30(21-32(39)40)36-20-19-28(22-36)26-12-10-25(11-13-26)24-7-5-4-6-8-24/h4-8,10-17,19-20,22-23,30H,9,18,21H2,1-3H3,(H,35,41)(H,39,40)/t30-/m0/s1 |
| InChIKey | XLNCSSXGAWSZBN-PMERELPUSA-N |
| XLogP | 6.13 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.67 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|