C30H39N3O8 — CID 57020353
methyl 4-[4-methylpentanoyl-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-phenylmethoxybutanoyl]amino]amino]benzoate (PubChem CID 57020353) has the molecular formula C30H39N3O8 and a molecular weight of 569.66 g/mol. Its IUPAC name is methyl 4-[4-methylpentanoyl-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-phenylmethoxybutanoyl]amino]amino]benzoate.
| Compound Name | methyl 4-[4-methylpentanoyl-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-phenylmethoxybutanoyl]amino]amino]benzoate |
|---|---|
| PubChem CID | 57020353 |
| Molecular Formula | C30H39N3O8 |
| Molecular Weight | 569.66 g/mol |
| Exact Mass | 569.27 |
| IUPAC Name | methyl 4-[4-methylpentanoyl-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-phenylmethoxybutanoyl]amino]amino]benzoate |
| SMILES | COC(=O)c1ccc(N(NC(=O)[C@H](CC(=O)OCc2ccccc2)NC(=O)OC(C)(C)C)C(=O)CCC(C)C)cc1 |
| InChI | InChI=1S/C30H39N3O8/c1-20(2)12-17-25(34)33(23-15-13-22(14-16-23)28(37)39-6)32-27(36)24(31-29(38)41-30(3,4)5)18-26(35)40-19-21-10-8-7-9-11-21/h7-11,13-16,20,24H,12,17-19H2,1-6H3,(H,31,38)(H,32,36)/t24-/m0/s1 |
| InChIKey | PGBWHSOYKXTPRG-DEOSSOPVSA-N |
| XLogP | 4.30 |
| TPSA | 140.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.66 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|