C40H39N3O6 — CID 70097211
4-[4-methylpentanoyl-[[(2S)-4-oxo-4-phenylmethoxy-2-[3-(4-phenylphenyl)pyrrol-1-yl]butanoyl]amino]amino]benzoic acid (PubChem CID 70097211) has the molecular formula C40H39N3O6 and a molecular weight of 657.77 g/mol. Its IUPAC name is 4-[4-methylpentanoyl-[[(2S)-4-oxo-4-phenylmethoxy-2-[3-(4-phenylphenyl)pyrrol-1-yl]butanoyl]amino]amino]benzoic acid.
| Compound Name | 4-[4-methylpentanoyl-[[(2S)-4-oxo-4-phenylmethoxy-2-[3-(4-phenylphenyl)pyrrol-1-yl]butanoyl]amino]amino]benzoic acid |
|---|---|
| PubChem CID | 70097211 |
| Molecular Formula | C40H39N3O6 |
| Molecular Weight | 657.77 g/mol |
| Exact Mass | 657.28 |
| IUPAC Name | 4-[4-methylpentanoyl-[[(2S)-4-oxo-4-phenylmethoxy-2-[3-(4-phenylphenyl)pyrrol-1-yl]butanoyl]amino]amino]benzoic acid |
| SMILES | CC(C)CCC(=O)N(NC(=O)[C@H](CC(=O)OCc1ccccc1)n1ccc(-c2ccc(-c3ccccc3)cc2)c1)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C40H39N3O6/c1-28(2)13-22-37(44)43(35-20-18-33(19-21-35)40(47)48)41-39(46)36(25-38(45)49-27-29-9-5-3-6-10-29)42-24-23-34(26-42)32-16-14-31(15-17-32)30-11-7-4-8-12-30/h3-12,14-21,23-24,26,28,36H,13,22,25,27H2,1-2H3,(H,41,46)(H,47,48)/t36-/m0/s1 |
| InChIKey | XSWQVXGZOVGLBR-BHVANESWSA-N |
| XLogP | 7.70 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.77 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|