C28H31N3O6 — CID 18380445
4-[4-methylpentanoyl-[(4-oxo-4-phenylmethoxy-2-pyrrol-1-ylbutanoyl)amino]amino]benzoic acid (PubChem CID 18380445) has the molecular formula C28H31N3O6 and a molecular weight of 505.57 g/mol. Its IUPAC name is 4-[4-methylpentanoyl-[(4-oxo-4-phenylmethoxy-2-pyrrol-1-ylbutanoyl)amino]amino]benzoic acid.
| Compound Name | 4-[4-methylpentanoyl-[(4-oxo-4-phenylmethoxy-2-pyrrol-1-ylbutanoyl)amino]amino]benzoic acid |
|---|---|
| PubChem CID | 18380445 |
| Molecular Formula | C28H31N3O6 |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | 4-[4-methylpentanoyl-[(4-oxo-4-phenylmethoxy-2-pyrrol-1-ylbutanoyl)amino]amino]benzoic acid |
| SMILES | CC(C)CCC(=O)N(NC(=O)C(CC(=O)OCc1ccccc1)n1cccc1)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C28H31N3O6/c1-20(2)10-15-25(32)31(23-13-11-22(12-14-23)28(35)36)29-27(34)24(30-16-6-7-17-30)18-26(33)37-19-21-8-4-3-5-9-21/h3-9,11-14,16-17,20,24H,10,15,18-19H2,1-2H3,(H,29,34)(H,35,36) |
| InChIKey | DFZCOXFUFHCFBV-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|