C23H35NO6 — CID 70463023
[3-hydroxy-2,2-dimethyl-4-oxo-4-[(4-oxo-4-phenylmethoxybutyl)amino]butyl] 4-methylpentanoate (PubChem CID 70463023) has the molecular formula C23H35NO6 and a molecular weight of 421.53 g/mol. Its IUPAC name is [3-hydroxy-2,2-dimethyl-4-oxo-4-[(4-oxo-4-phenylmethoxybutyl)amino]butyl] 4-methylpentanoate.
| Compound Name | [3-hydroxy-2,2-dimethyl-4-oxo-4-[(4-oxo-4-phenylmethoxybutyl)amino]butyl] 4-methylpentanoate |
|---|---|
| PubChem CID | 70463023 |
| Molecular Formula | C23H35NO6 |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | [3-hydroxy-2,2-dimethyl-4-oxo-4-[(4-oxo-4-phenylmethoxybutyl)amino]butyl] 4-methylpentanoate |
| SMILES | CC(C)CCC(=O)OCC(C)(C)C(O)C(=O)NCCCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H35NO6/c1-17(2)12-13-20(26)30-16-23(3,4)21(27)22(28)24-14-8-11-19(25)29-15-18-9-6-5-7-10-18/h5-7,9-10,17,21,27H,8,11-16H2,1-4H3,(H,24,28) |
| InChIKey | FDHWMOCTERHQHQ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|