C24H34ClNO4 — CID 57277373
[(8S,9R,10S,13S,14S)-2-cyano-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-acetyloxy-2-chloroacetate (PubChem CID 57277373) has the molecular formula C24H34ClNO4 and a molecular weight of 435.99 g/mol. Its IUPAC name is [(8S,9R,10S,13S,14S)-2-cyano-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-acetyloxy-2-chloroacetate.
| Compound Name | [(8S,9R,10S,13S,14S)-2-cyano-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-acetyloxy-2-chloroacetate |
|---|---|
| PubChem CID | 57277373 |
| Molecular Formula | C24H34ClNO4 |
| Molecular Weight | 435.99 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | [(8S,9R,10S,13S,14S)-2-cyano-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-acetyloxy-2-chloroacetate |
| SMILES | CC(=O)OC(Cl)C(=O)OC1CC2CC[C@@H]3[C@@H](CC[C@]4(C)CCC[C@@H]34)[C@@]2(C)CC1C#N |
| InChI | InChI=1S/C24H34ClNO4/c1-14(27)29-21(25)22(28)30-20-11-16-6-7-17-18-5-4-9-23(18,2)10-8-19(17)24(16,3)12-15(20)13-26/h15-21H,4-12H2,1-3H3/t15?,16?,17-,18-,19+,20?,21?,23-,24-/m0/s1 |
| InChIKey | HASCJPFHOUGBJU-ULXIOCAGSA-N |
| XLogP | 5.21 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.99 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|