C23H25N5O3 — CID 57277590
methyl (2R)-2-[(2-butyl-3H-benzimidazol-5-yl)carbamoylamino]-3-(3-cyanophenyl)propanoate (PubChem CID 57277590) has the molecular formula C23H25N5O3 and a molecular weight of 419.49 g/mol. Its IUPAC name is methyl (2R)-2-[(2-butyl-3H-benzimidazol-5-yl)carbamoylamino]-3-(3-cyanophenyl)propanoate.
| Compound Name | methyl (2R)-2-[(2-butyl-3H-benzimidazol-5-yl)carbamoylamino]-3-(3-cyanophenyl)propanoate |
|---|---|
| PubChem CID | 57277590 |
| Molecular Formula | C23H25N5O3 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | methyl (2R)-2-[(2-butyl-3H-benzimidazol-5-yl)carbamoylamino]-3-(3-cyanophenyl)propanoate |
| SMILES | CCCCc1nc2ccc(NC(=O)N[C@H](Cc3cccc(C#N)c3)C(=O)OC)cc2[nH]1 |
| InChI | InChI=1S/C23H25N5O3/c1-3-4-8-21-26-18-10-9-17(13-19(18)27-21)25-23(30)28-20(22(29)31-2)12-15-6-5-7-16(11-15)14-24/h5-7,9-11,13,20H,3-4,8,12H2,1-2H3,(H,26,27)(H2,25,28,30)/t20-/m1/s1 |
| InChIKey | DOCOZWFVSGBVIT-HXUWFJFHSA-N |
| XLogP | 3.68 |
| TPSA | 119.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |