C25H19N3O3S — CID 57278075
[2-ethyl-3-(5-phenyl-1,3,4-oxadiazol-2-yl)-1,2-benzothiazin-4-yl] benzoate (PubChem CID 57278075) has the molecular formula C25H19N3O3S and a molecular weight of 441.51 g/mol. Its IUPAC name is [2-ethyl-3-(5-phenyl-1,3,4-oxadiazol-2-yl)-1,2-benzothiazin-4-yl] benzoate.
| Compound Name | [2-ethyl-3-(5-phenyl-1,3,4-oxadiazol-2-yl)-1,2-benzothiazin-4-yl] benzoate |
|---|---|
| PubChem CID | 57278075 |
| Molecular Formula | C25H19N3O3S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | [2-ethyl-3-(5-phenyl-1,3,4-oxadiazol-2-yl)-1,2-benzothiazin-4-yl] benzoate |
| SMILES | CCN1Sc2ccccc2C(OC(=O)c2ccccc2)=C1c1nnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C25H19N3O3S/c1-2-28-21(24-27-26-23(31-24)17-11-5-3-6-12-17)22(19-15-9-10-16-20(19)32-28)30-25(29)18-13-7-4-8-14-18/h3-16H,2H2,1H3 |
| InChIKey | OTYOAIWUJAAUHI-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|