C24H33ClN2O6S — CID 57281523
N-[2-[3-[2-(4-chlorophenoxy)ethoxy]-2-methoxyphenyl]ethyl]-2-(ethylsulfonylamino)-3-methylbutanamide (PubChem CID 57281523) has the molecular formula C24H33ClN2O6S and a molecular weight of 513.06 g/mol. Its IUPAC name is N-[2-[3-[2-(4-chlorophenoxy)ethoxy]-2-methoxyphenyl]ethyl]-2-(ethylsulfonylamino)-3-methylbutanamide.
| Compound Name | N-[2-[3-[2-(4-chlorophenoxy)ethoxy]-2-methoxyphenyl]ethyl]-2-(ethylsulfonylamino)-3-methylbutanamide |
|---|---|
| PubChem CID | 57281523 |
| Molecular Formula | C24H33ClN2O6S |
| Molecular Weight | 513.06 g/mol |
| Exact Mass | 512.17 |
| IUPAC Name | N-[2-[3-[2-(4-chlorophenoxy)ethoxy]-2-methoxyphenyl]ethyl]-2-(ethylsulfonylamino)-3-methylbutanamide |
| SMILES | CCS(=O)(=O)NC(C(=O)NCCc1cccc(OCCOc2ccc(Cl)cc2)c1OC)C(C)C |
| InChI | InChI=1S/C24H33ClN2O6S/c1-5-34(29,30)27-22(17(2)3)24(28)26-14-13-18-7-6-8-21(23(18)31-4)33-16-15-32-20-11-9-19(25)10-12-20/h6-12,17,22,27H,5,13-16H2,1-4H3,(H,26,28) |
| InChIKey | JFSFLZIFEWTGEO-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.06 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|