C24H34FN3O6S — CID 57049916
2-(dimethylsulfamoylamino)-N-[2-[3-[2-(4-fluorophenoxy)ethoxy]-2-methoxyphenyl]ethyl]-3-methylbutanamide (PubChem CID 57049916) has the molecular formula C24H34FN3O6S and a molecular weight of 511.62 g/mol. Its IUPAC name is 2-(dimethylsulfamoylamino)-N-[2-[3-[2-(4-fluorophenoxy)ethoxy]-2-methoxyphenyl]ethyl]-3-methylbutanamide.
| Compound Name | 2-(dimethylsulfamoylamino)-N-[2-[3-[2-(4-fluorophenoxy)ethoxy]-2-methoxyphenyl]ethyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 57049916 |
| Molecular Formula | C24H34FN3O6S |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.22 |
| IUPAC Name | 2-(dimethylsulfamoylamino)-N-[2-[3-[2-(4-fluorophenoxy)ethoxy]-2-methoxyphenyl]ethyl]-3-methylbutanamide |
| SMILES | COc1c(CCNC(=O)C(NS(=O)(=O)N(C)C)C(C)C)cccc1OCCOc1ccc(F)cc1 |
| InChI | InChI=1S/C24H34FN3O6S/c1-17(2)22(27-35(30,31)28(3)4)24(29)26-14-13-18-7-6-8-21(23(18)32-5)34-16-15-33-20-11-9-19(25)10-12-20/h6-12,17,22,27H,13-16H2,1-5H3,(H,26,29) |
| InChIKey | XCFHMXQDBJMMGT-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|