C15H26O5 — CID 57281616
3-[(1R,2S,4S,6S)-1,2-bis(hydroxymethyl)-6-methyl-7-oxabicyclo[2.2.1]heptan-2-yl]-2,2-dimethylbutanoic acid (PubChem CID 57281616) has the molecular formula C15H26O5 and a molecular weight of 286.37 g/mol. Its IUPAC name is 3-[(1R,2S,4S,6S)-1,2-bis(hydroxymethyl)-6-methyl-7-oxabicyclo[2.2.1]heptan-2-yl]-2,2-dimethylbutanoic acid.
| Compound Name | 3-[(1R,2S,4S,6S)-1,2-bis(hydroxymethyl)-6-methyl-7-oxabicyclo[2.2.1]heptan-2-yl]-2,2-dimethylbutanoic acid |
|---|---|
| PubChem CID | 57281616 |
| Molecular Formula | C15H26O5 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 3-[(1R,2S,4S,6S)-1,2-bis(hydroxymethyl)-6-methyl-7-oxabicyclo[2.2.1]heptan-2-yl]-2,2-dimethylbutanoic acid |
| SMILES | CC(C(C)(C)C(=O)O)[C@]1(CO)C[C@@H]2C[C@H](C)[C@@]1(CO)O2 |
| InChI | InChI=1S/C15H26O5/c1-9-5-11-6-14(7-16,15(9,8-17)20-11)10(2)13(3,4)12(18)19/h9-11,16-17H,5-8H2,1-4H3,(H,18,19)/t9-,10?,11-,14+,15+/m0/s1 |
| InChIKey | RDVGHHSIFSQMNZ-GJGDVDLFSA-N |
| XLogP | 1.27 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |