C14H28N2 — CID 57282188
2-methyl-1-N'-(3-methylcyclohexyl)cyclohexane-1,1-diamine (PubChem CID 57282188) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is 2-methyl-1-N'-(3-methylcyclohexyl)cyclohexane-1,1-diamine.
| Compound Name | 2-methyl-1-N'-(3-methylcyclohexyl)cyclohexane-1,1-diamine |
|---|---|
| PubChem CID | 57282188 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | 2-methyl-1-N'-(3-methylcyclohexyl)cyclohexane-1,1-diamine |
| SMILES | CC1CCCC(NC2(N)CCCCC2C)C1 |
| InChI | InChI=1S/C14H28N2/c1-11-6-5-8-13(10-11)16-14(15)9-4-3-7-12(14)2/h11-13,16H,3-10,15H2,1-2H3 |
| InChIKey | NWXOFZWEQDIICP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|