C7H8O2 — CID 57285343
3a,6-dihydro-1,3-benzodioxole (PubChem CID 57285343) has the molecular formula C7H8O2 and a molecular weight of 124.14 g/mol. Its IUPAC name is 3a,6-dihydro-1,3-benzodioxole.
| Compound Name | 3a,6-dihydro-1,3-benzodioxole |
|---|---|
| PubChem CID | 57285343 |
| Molecular Formula | C7H8O2 |
| Molecular Weight | 124.14 g/mol |
| Exact Mass | 124.05 |
| IUPAC Name | 3a,6-dihydro-1,3-benzodioxole |
| SMILES | C1=CC2OCOC2=CC1 |
| InChI | InChI=1S/C7H8O2/c1-2-4-7-6(3-1)8-5-9-7/h1,3-4,6H,2,5H2 |
| InChIKey | RZYAHZNNOXTXPA-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.14 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|