C32H41N5O2 — CID 57285427
4-methyl-N'-[4-[4-(2-phenylphenyl)piperazin-1-yl]butyl]-2-(pyridin-3-ylmethyl)pentanediamide (PubChem CID 57285427) has the molecular formula C32H41N5O2 and a molecular weight of 527.71 g/mol. Its IUPAC name is 4-methyl-N'-[4-[4-(2-phenylphenyl)piperazin-1-yl]butyl]-2-(pyridin-3-ylmethyl)pentanediamide.
| Compound Name | 4-methyl-N'-[4-[4-(2-phenylphenyl)piperazin-1-yl]butyl]-2-(pyridin-3-ylmethyl)pentanediamide |
|---|---|
| PubChem CID | 57285427 |
| Molecular Formula | C32H41N5O2 |
| Molecular Weight | 527.71 g/mol |
| Exact Mass | 527.33 |
| IUPAC Name | 4-methyl-N'-[4-[4-(2-phenylphenyl)piperazin-1-yl]butyl]-2-(pyridin-3-ylmethyl)pentanediamide |
| SMILES | CC(CC(Cc1cccnc1)C(N)=O)C(=O)NCCCCN1CCN(c2ccccc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C32H41N5O2/c1-25(22-28(31(33)38)23-26-10-9-15-34-24-26)32(39)35-16-7-8-17-36-18-20-37(21-19-36)30-14-6-5-13-29(30)27-11-3-2-4-12-27/h2-6,9-15,24-25,28H,7-8,16-23H2,1H3,(H2,33,38)(H,35,39) |
| InChIKey | QFSWMIZUXLFTMK-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.71 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|